C14H27N5O3 — CID 111164107
ethyl 4-[N'-methyl-N-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164107) has the molecular formula C14H27N5O3 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl 4-[N'-methyl-N-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N'-methyl-N-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164107 |
| Molecular Formula | C14H27N5O3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | ethyl 4-[N'-methyl-N-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCCNC(=O)CN/C(=N\C)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C14H27N5O3/c1-4-6-16-12(20)11-17-13(15-3)18-7-9-19(10-8-18)14(21)22-5-2/h4-11H2,1-3H3,(H,15,17)(H,16,20) |
| InChIKey | ACODNBNWLZSIME-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|