C15H31N5O4S — CID 111164791
ethyl 4-[N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164791) has the molecular formula C15H31N5O4S and a molecular weight of 377.51 g/mol. Its IUPAC name is ethyl 4-[N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164791 |
| Molecular Formula | C15H31N5O4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | ethyl 4-[N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCCCN(CC)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H31N5O4S/c1-5-20(25(4,22)23)9-7-8-17-14(16-3)18-10-12-19(13-11-18)15(21)24-6-2/h5-13H2,1-4H3,(H,16,17) |
| InChIKey | VVFWPJJYTAZRSY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|