C18H37N5O2 — CID 111164025
ethyl 4-[N-[7-(dimethylamino)heptyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164025) has the molecular formula C18H37N5O2 and a molecular weight of 355.53 g/mol. Its IUPAC name is ethyl 4-[N-[7-(dimethylamino)heptyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[7-(dimethylamino)heptyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164025 |
| Molecular Formula | C18H37N5O2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | ethyl 4-[N-[7-(dimethylamino)heptyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCCCCCCCN(C)C)CC1 |
| InChI | InChI=1S/C18H37N5O2/c1-5-25-18(24)23-15-13-22(14-16-23)17(19-2)20-11-9-7-6-8-10-12-21(3)4/h5-16H2,1-4H3,(H,19,20) |
| InChIKey | XHJTYKMOOMUSKA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|