C13H24N4O4 — CID 108529556
ethyl 4-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperazine-1-carboxylate (PubChem CID 108529556) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is ethyl 4-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108529556 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | ethyl 4-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(=O)NCCN(C)C)CC1 |
| InChI | InChI=1S/C13H24N4O4/c1-4-21-13(20)17-9-7-16(8-10-17)12(19)11(18)14-5-6-15(2)3/h4-10H2,1-3H3,(H,14,18) |
| InChIKey | IPEDZZYZFSCJGV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|