C14H28N4O3 — CID 108994613
ethyl 4-[[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]amino]piperidine-1-carboxylate (PubChem CID 108994613) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108994613 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | ethyl 4-[[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCC(=O)NCCN(C)C)CC1 |
| InChI | InChI=1S/C14H28N4O3/c1-4-21-14(20)18-8-5-12(6-9-18)16-11-13(19)15-7-10-17(2)3/h12,16H,4-11H2,1-3H3,(H,15,19) |
| InChIKey | NHJUQFJINCEVNQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |