C12H23N3O3 — CID 28586131
ethyl 4-[[2-(dimethylamino)-2-oxoethyl]amino]piperidine-1-carboxylate (PubChem CID 28586131) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl 4-[[2-(dimethylamino)-2-oxoethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(dimethylamino)-2-oxoethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 28586131 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | ethyl 4-[[2-(dimethylamino)-2-oxoethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H23N3O3/c1-4-18-12(17)15-7-5-10(6-8-15)13-9-11(16)14(2)3/h10,13H,4-9H2,1-3H3 |
| InChIKey | JSAPCZHWCVGKEQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |