C18H28N4O3 — CID 109001487
ethyl 4-[[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]amino]piperidine-1-carboxylate (PubChem CID 109001487) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 4-[[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109001487 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | ethyl 4-[[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCC(=O)N(C)CCc2ccncc2)CC1 |
| InChI | InChI=1S/C18H28N4O3/c1-3-25-18(24)22-12-7-16(8-13-22)20-14-17(23)21(2)11-6-15-4-9-19-10-5-15/h4-5,9-10,16,20H,3,6-8,11-14H2,1-2H3 |
| InChIKey | IOYXXEPOBJQVON-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |