C17H26N4O3 — CID 109023796
ethyl 4-[[3-oxo-3-(pyridin-4-ylmethylamino)propyl]amino]piperidine-1-carboxylate (PubChem CID 109023796) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 4-[[3-oxo-3-(pyridin-4-ylmethylamino)propyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-oxo-3-(pyridin-4-ylmethylamino)propyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109023796 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | ethyl 4-[[3-oxo-3-(pyridin-4-ylmethylamino)propyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCC(=O)NCc2ccncc2)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-2-24-17(23)21-11-6-15(7-12-21)19-10-5-16(22)20-13-14-3-8-18-9-4-14/h3-4,8-9,15,19H,2,5-7,10-13H2,1H3,(H,20,22) |
| InChIKey | WHPWGFHONDHJQP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |