C18H24N4O4 — CID 108976948
ethyl 4-[1-(pyridin-4-ylmethylcarbamoyl)cyclopropanecarbonyl]piperazine-1-carboxylate (PubChem CID 108976948) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 4-[1-(pyridin-4-ylmethylcarbamoyl)cyclopropanecarbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(pyridin-4-ylmethylcarbamoyl)cyclopropanecarbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108976948 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl 4-[1-(pyridin-4-ylmethylcarbamoyl)cyclopropanecarbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2(C(=O)NCc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C18H24N4O4/c1-2-26-17(25)22-11-9-21(10-12-22)16(24)18(5-6-18)15(23)20-13-14-3-7-19-8-4-14/h3-4,7-8H,2,5-6,9-13H2,1H3,(H,20,23) |
| InChIKey | GLXJSEPEOXHJNJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|