C10H21N3O2 — CID 83003000
ethyl 4-(2,2-dimethylhydrazinyl)piperidine-1-carboxylate (PubChem CID 83003000) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is ethyl 4-(2,2-dimethylhydrazinyl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(2,2-dimethylhydrazinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 83003000 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | ethyl 4-(2,2-dimethylhydrazinyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NN(C)C)CC1 |
| InChI | InChI=1S/C10H21N3O2/c1-4-15-10(14)13-7-5-9(6-8-13)11-12(2)3/h9,11H,4-8H2,1-3H3 |
| InChIKey | ZBKUICZSEXPTAP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|