C13H26N4O3 — CID 83117025
ethyl 4-[2-(dimethylcarbamoylamino)ethylamino]piperidine-1-carboxylate (PubChem CID 83117025) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is ethyl 4-[2-(dimethylcarbamoylamino)ethylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-(dimethylcarbamoylamino)ethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 83117025 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | ethyl 4-[2-(dimethylcarbamoylamino)ethylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCNC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C13H26N4O3/c1-4-20-13(19)17-9-5-11(6-10-17)14-7-8-15-12(18)16(2)3/h11,14H,4-10H2,1-3H3,(H,15,18) |
| InChIKey | KCEHAUZFCYNRCZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|