C11H24N4O — CID 83116217
1,1-dimethyl-3-[2-[(1-methylpiperidin-4-yl)amino]ethyl]urea (PubChem CID 83116217) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(1-methylpiperidin-4-yl)amino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(1-methylpiperidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 83116217 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(1-methylpiperidin-4-yl)amino]ethyl]urea |
| SMILES | CN1CCC(NCCNC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C11H24N4O/c1-14(2)11(16)13-7-6-12-10-4-8-15(3)9-5-10/h10,12H,4-9H2,1-3H3,(H,13,16) |
| InChIKey | OEMRJMCPFXGVEH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|