C10H21N3O3S — CID 83117132
3-[2-[(1,1-dioxothian-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83117132) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-[2-[(1,1-dioxothian-4-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(1,1-dioxothian-4-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83117132 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-[2-[(1,1-dioxothian-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H21N3O3S/c1-13(2)10(14)12-6-5-11-9-3-7-17(15,16)8-4-9/h9,11H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | MJFMVKWCZHAPDO-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|