C15H30N2O2S — CID 60980818
N'-cyclohexyl-N-(1,1-dioxothian-4-yl)-N'-methylpropane-1,3-diamine (PubChem CID 60980818) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is N'-cyclohexyl-N-(1,1-dioxothian-4-yl)-N'-methylpropane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N-(1,1-dioxothian-4-yl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60980818 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N'-cyclohexyl-N-(1,1-dioxothian-4-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNC1CCS(=O)(=O)CC1)C1CCCCC1 |
| InChI | InChI=1S/C15H30N2O2S/c1-17(15-6-3-2-4-7-15)11-5-10-16-14-8-12-20(18,19)13-9-14/h14-16H,2-13H2,1H3 |
| InChIKey | HIPGPBJHMCXCKM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|