C10H22N2O2S — CID 43511552
N-(1,1-dioxothian-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 43511552) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(1,1-dioxothian-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43511552 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H22N2O2S/c1-12(2)7-3-6-11-10-4-8-15(13,14)9-5-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | IBTQSCRGIMJOIK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|