C12H28N4 — CID 117027507
N-[1-(2-aminoethyl)piperidin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 117027507) has the molecular formula C12H28N4 and a molecular weight of 228.38 g/mol. Its IUPAC name is N-[1-(2-aminoethyl)piperidin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[1-(2-aminoethyl)piperidin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 117027507 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | N-[1-(2-aminoethyl)piperidin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNC1CCN(CCN)CC1 |
| InChI | InChI=1S/C12H28N4/c1-15(2)8-3-7-14-12-4-9-16(10-5-12)11-6-13/h12,14H,3-11,13H2,1-2H3 |
| InChIKey | VHUVZGNLPRMNPR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|