C9H19N3O3S — CID 77027987
4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxybutanimidamide (PubChem CID 77027987) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxybutanimidamide.
| Compound Name | 4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77027987 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxybutanimidamide |
| SMILES | NC(CCCNC1CCS(=O)(=O)CC1)=NO |
| InChI | InChI=1S/C9H19N3O3S/c10-9(12-13)2-1-5-11-8-3-6-16(14,15)7-4-8/h8,11,13H,1-7H2,(H2,10,12) |
| InChIKey | LPHJBTVUTQKKLD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|