C14H28N2S — CID 54880266
N'-cyclohexyl-N'-methyl-N-(thiolan-3-yl)propane-1,3-diamine (PubChem CID 54880266) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-(thiolan-3-yl)propane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-methyl-N-(thiolan-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54880266 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-(thiolan-3-yl)propane-1,3-diamine |
| SMILES | CN(CCCNC1CCSC1)C1CCCCC1 |
| InChI | InChI=1S/C14H28N2S/c1-16(14-6-3-2-4-7-14)10-5-9-15-13-8-11-17-12-13/h13-15H,2-12H2,1H3 |
| InChIKey | DFISHLWCQDHUHA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|