C15H30N2S — CID 107131892
N'-cyclohexyl-N'-methyl-N-(thiolan-3-ylmethyl)propane-1,3-diamine (PubChem CID 107131892) has the molecular formula C15H30N2S and a molecular weight of 270.49 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-(thiolan-3-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-methyl-N-(thiolan-3-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107131892 |
| Molecular Formula | C15H30N2S |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-(thiolan-3-ylmethyl)propane-1,3-diamine |
| SMILES | CN(CCCNCC1CCSC1)C1CCCCC1 |
| InChI | InChI=1S/C15H30N2S/c1-17(15-6-3-2-4-7-15)10-5-9-16-12-14-8-11-18-13-14/h14-16H,2-13H2,1H3 |
| InChIKey | SHJSCIONXHYITQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|