C11H23N3O — CID 83115963
1,1-dimethyl-3-[2-[(3-methylcyclopentyl)amino]ethyl]urea (PubChem CID 83115963) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(3-methylcyclopentyl)amino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(3-methylcyclopentyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 83115963 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(3-methylcyclopentyl)amino]ethyl]urea |
| SMILES | CC1CCC(NCCNC(=O)N(C)C)C1 |
| InChI | InChI=1S/C11H23N3O/c1-9-4-5-10(8-9)12-6-7-13-11(15)14(2)3/h9-10,12H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | KSHQCIBGGANOOV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|