C15H31N3O — CID 112682262
1,1-dimethyl-3-[2-[(3,3,5,5-tetramethylcyclohexyl)amino]ethyl]urea (PubChem CID 112682262) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(3,3,5,5-tetramethylcyclohexyl)amino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(3,3,5,5-tetramethylcyclohexyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 112682262 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(3,3,5,5-tetramethylcyclohexyl)amino]ethyl]urea |
| SMILES | CN(C)C(=O)NCCNC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H31N3O/c1-14(2)9-12(10-15(3,4)11-14)16-7-8-17-13(19)18(5)6/h12,16H,7-11H2,1-6H3,(H,17,19) |
| InChIKey | NREVWAYMXVIALM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|