C11H23N3O2 — CID 106595003
3-[2-[(4-hydroxycyclohexyl)amino]ethyl]-1,1-dimethylurea (PubChem CID 106595003) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-[2-[(4-hydroxycyclohexyl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-hydroxycyclohexyl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 106595003 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3-[2-[(4-hydroxycyclohexyl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNC1CCC(O)CC1 |
| InChI | InChI=1S/C11H23N3O2/c1-14(2)11(16)13-8-7-12-9-3-5-10(15)6-4-9/h9-10,12,15H,3-8H2,1-2H3,(H,13,16) |
| InChIKey | PKKQKEIPPSIXHJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|