C12H22N2O — CID 97357833
N-[2-[[(1S,3R)-3-methylcyclopentyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 97357833) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[2-[[(1S,3R)-3-methylcyclopentyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[(1S,3R)-3-methylcyclopentyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 97357833 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[2-[[(1S,3R)-3-methylcyclopentyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | C[C@@H]1CC[C@H](NCCNC(=O)C2CC2)C1 |
| InChI | InChI=1S/C12H22N2O/c1-9-2-5-11(8-9)13-6-7-14-12(15)10-3-4-10/h9-11,13H,2-8H2,1H3,(H,14,15)/t9-,11+/m1/s1 |
| InChIKey | ZNPNRUJUZHPBTD-KOLCDFICSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|