C14H24N2O2 — CID 109144255
4-N-cyclopropyl-1-N-propylcyclohexane-1,4-dicarboxamide (PubChem CID 109144255) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-N-cyclopropyl-1-N-propylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-cyclopropyl-1-N-propylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109144255 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 4-N-cyclopropyl-1-N-propylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCNC(=O)C1CCC(C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-2-9-15-13(17)10-3-5-11(6-4-10)14(18)16-12-7-8-12/h10-12H,2-9H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | ZNNINUSJAAQQBP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |