C16H30N2O2 — CID 109144333
4-N-(3-methylbutyl)-1-N-propylcyclohexane-1,4-dicarboxamide (PubChem CID 109144333) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-N-(3-methylbutyl)-1-N-propylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-methylbutyl)-1-N-propylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109144333 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 4-N-(3-methylbutyl)-1-N-propylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCNC(=O)C1CCC(C(=O)NCCC(C)C)CC1 |
| InChI | InChI=1S/C16H30N2O2/c1-4-10-17-15(19)13-5-7-14(8-6-13)16(20)18-11-9-12(2)3/h12-14H,4-11H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | DVDILJWKXOWCBD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |