C15H32N4O2S — CID 111154674
N-[3-[ethyl(methylsulfonyl)amino]propyl]-N',3,5-trimethylpiperidine-1-carboximidamide (PubChem CID 111154674) has the molecular formula C15H32N4O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-N',3,5-trimethylpiperidine-1-carboximidamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111154674 |
| Molecular Formula | C15H32N4O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
| SMILES | CCN(CCCN/C(=N\C)N1CC(C)CC(C)C1)S(C)(=O)=O |
| InChI | InChI=1S/C15H32N4O2S/c1-6-19(22(5,20)21)9-7-8-17-15(16-4)18-11-13(2)10-14(3)12-18/h13-14H,6-12H2,1-5H3,(H,16,17) |
| InChIKey | NRCAQHCHNSIAFV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|