C16H34N4 — CID 111154501
N-[2-[ethyl(propan-2-yl)amino]ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide (PubChem CID 111154501) has the molecular formula C16H34N4 and a molecular weight of 282.48 g/mol. Its IUPAC name is N-[2-[ethyl(propan-2-yl)amino]ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide.
| Compound Name | N-[2-[ethyl(propan-2-yl)amino]ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111154501 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | N-[2-[ethyl(propan-2-yl)amino]ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
| SMILES | CCN(CCN/C(=N\C)N1CC(C)CC(C)C1)C(C)C |
| InChI | InChI=1S/C16H34N4/c1-7-19(13(2)3)9-8-18-16(17-6)20-11-14(4)10-15(5)12-20/h13-15H,7-12H2,1-6H3,(H,17,18) |
| InChIKey | ZJSCVRAAXLVILE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|