C16H29N3O4 — CID 108965329
ethyl 4-[3-(diethylamino)-2,2-dimethyl-3-oxopropanoyl]piperazine-1-carboxylate (PubChem CID 108965329) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is ethyl 4-[3-(diethylamino)-2,2-dimethyl-3-oxopropanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(diethylamino)-2,2-dimethyl-3-oxopropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108965329 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | ethyl 4-[3-(diethylamino)-2,2-dimethyl-3-oxopropanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)(C)C(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C16H29N3O4/c1-6-17(7-2)13(20)16(4,5)14(21)18-9-11-19(12-10-18)15(22)23-8-3/h6-12H2,1-5H3 |
| InChIKey | XTMZEZQFUICJTL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|