C17H33N3O2 — CID 108960910
3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide (PubChem CID 108960910) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 108960910 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(C)(C)C(=O)N1CCN(CC)CC1 |
| InChI | InChI=1S/C17H33N3O2/c1-6-9-19(10-7-2)15(21)17(4,5)16(22)20-13-11-18(8-3)12-14-20/h6-14H2,1-5H3 |
| InChIKey | NBKGNSLRSFCWDG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|