C16H26F4N4O2 — CID 4167516
1,4-bis(4-ethylpiperazin-1-yl)-2,2,3,3-tetrafluorobutane-1,4-dione (PubChem CID 4167516) has the molecular formula C16H26F4N4O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is 1,4-bis(4-ethylpiperazin-1-yl)-2,2,3,3-tetrafluorobutane-1,4-dione.
| Compound Name | 1,4-bis(4-ethylpiperazin-1-yl)-2,2,3,3-tetrafluorobutane-1,4-dione |
|---|---|
| PubChem CID | 4167516 |
| Molecular Formula | C16H26F4N4O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1,4-bis(4-ethylpiperazin-1-yl)-2,2,3,3-tetrafluorobutane-1,4-dione |
| SMILES | CCN1CCN(C(=O)C(F)(F)C(F)(F)C(=O)N2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C16H26F4N4O2/c1-3-21-5-9-23(10-6-21)13(25)15(17,18)16(19,20)14(26)24-11-7-22(4-2)8-12-24/h3-12H2,1-2H3 |
| InChIKey | IQTUVXDZHOMUAV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|