C10H11F5N2O — CID 114038095
2,2,3,3,3-pentafluoro-1-(4-prop-2-ynylpiperazin-1-yl)propan-1-one (PubChem CID 114038095) has the molecular formula C10H11F5N2O and a molecular weight of 270.20 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-prop-2-ynylpiperazin-1-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-prop-2-ynylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 114038095 |
| Molecular Formula | C10H11F5N2O |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-prop-2-ynylpiperazin-1-yl)propan-1-one |
| SMILES | C#CCN1CCN(C(=O)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F5N2O/c1-2-3-16-4-6-17(7-5-16)8(18)9(11,12)10(13,14)15/h1H,3-7H2 |
| InChIKey | KUUHMRUKAUYURT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|