C14H20F4N2O2 — CID 4999121
2,2,3,3-tetrafluoro-1,4-di(piperidin-1-yl)butane-1,4-dione (PubChem CID 4999121) has the molecular formula C14H20F4N2O2 and a molecular weight of 324.32 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1,4-di(piperidin-1-yl)butane-1,4-dione.
| Compound Name | 2,2,3,3-tetrafluoro-1,4-di(piperidin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 4999121 |
| Molecular Formula | C14H20F4N2O2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1,4-di(piperidin-1-yl)butane-1,4-dione |
| SMILES | O=C(N1CCCCC1)C(F)(F)C(F)(F)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H20F4N2O2/c15-13(16,11(21)19-7-3-1-4-8-19)14(17,18)12(22)20-9-5-2-6-10-20/h1-10H2 |
| InChIKey | ZBOHERIHURSWJI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|