C14H20F4N3O6S2- — CID 58100504
bis[(1,1-difluoro-2-oxo-2-piperidin-1-ylethyl)sulfonyl]azanide (PubChem CID 58100504) has the molecular formula C14H20F4N3O6S2- and a molecular weight of 466.46 g/mol. Its IUPAC name is bis[(1,1-difluoro-2-oxo-2-piperidin-1-ylethyl)sulfonyl]azanide.
| Compound Name | bis[(1,1-difluoro-2-oxo-2-piperidin-1-ylethyl)sulfonyl]azanide |
|---|---|
| PubChem CID | 58100504 |
| Molecular Formula | C14H20F4N3O6S2- |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | bis[(1,1-difluoro-2-oxo-2-piperidin-1-ylethyl)sulfonyl]azanide |
| SMILES | O=C(N1CCCCC1)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H20F4N3O6S2/c15-13(16,11(22)20-7-3-1-4-8-20)28(24,25)19-29(26,27)14(17,18)12(23)21-9-5-2-6-10-21/h1-10H2/q-1 |
| InChIKey | LZVMSMFLFPQOJO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 123.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |