C10H16F2N2O5S — CID 1356929
2,2-difluoro-1-morpholin-4-yl-2-morpholin-4-ylsulfonylethanone (PubChem CID 1356929) has the molecular formula C10H16F2N2O5S and a molecular weight of 314.31 g/mol. Its IUPAC name is 2,2-difluoro-1-morpholin-4-yl-2-morpholin-4-ylsulfonylethanone.
| Compound Name | 2,2-difluoro-1-morpholin-4-yl-2-morpholin-4-ylsulfonylethanone |
|---|---|
| PubChem CID | 1356929 |
| Molecular Formula | C10H16F2N2O5S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2,2-difluoro-1-morpholin-4-yl-2-morpholin-4-ylsulfonylethanone |
| SMILES | O=C(N1CCOCC1)C(F)(F)S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H16F2N2O5S/c11-10(12,9(15)13-1-5-18-6-2-13)20(16,17)14-3-7-19-8-4-14/h1-8H2 |
| InChIKey | YOCMLYWEMSKBMA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |