C14H23F2NO2 — CID 168720301
5-ethyl-2,2-difluoro-4-methylidene-1-morpholin-4-ylheptan-1-one (PubChem CID 168720301) has the molecular formula C14H23F2NO2 and a molecular weight of 275.34 g/mol. Its IUPAC name is 5-ethyl-2,2-difluoro-4-methylidene-1-morpholin-4-ylheptan-1-one.
| Compound Name | 5-ethyl-2,2-difluoro-4-methylidene-1-morpholin-4-ylheptan-1-one |
|---|---|
| PubChem CID | 168720301 |
| Molecular Formula | C14H23F2NO2 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-ethyl-2,2-difluoro-4-methylidene-1-morpholin-4-ylheptan-1-one |
| SMILES | C=C(CC(F)(F)C(=O)N1CCOCC1)C(CC)CC |
| InChI | InChI=1S/C14H23F2NO2/c1-4-12(5-2)11(3)10-14(15,16)13(18)17-6-8-19-9-7-17/h12H,3-10H2,1-2H3 |
| InChIKey | WTQRBLXTSWAQJX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|