C12H19F6N2O8P — CID 118496995
phosphoric acid;bis(2,2,2-trifluoro-1-morpholin-4-ylethanone) (PubChem CID 118496995) has the molecular formula C12H19F6N2O8P and a molecular weight of 464.25 g/mol. Its IUPAC name is phosphoric acid;bis(2,2,2-trifluoro-1-morpholin-4-ylethanone).
| Compound Name | phosphoric acid;bis(2,2,2-trifluoro-1-morpholin-4-ylethanone) |
|---|---|
| PubChem CID | 118496995 |
| Molecular Formula | C12H19F6N2O8P |
| Molecular Weight | 464.25 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | phosphoric acid;bis(2,2,2-trifluoro-1-morpholin-4-ylethanone) |
| SMILES | O=C(N1CCOCC1)C(F)(F)F.O=C(N1CCOCC1)C(F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/2C6H8F3NO2.H3O4P/c2*7-6(8,9)5(11)10-1-3-12-4-2-10;1-5(2,3)4/h2*1-4H2;(H3,1,2,3,4) |
| InChIKey | IUBPLXCZCPIFHP-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|