C7H15NO6S2 — CID 126656739
2-morpholin-4-ylsulfonylpropane-2-sulfonic acid (PubChem CID 126656739) has the molecular formula C7H15NO6S2 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-morpholin-4-ylsulfonylpropane-2-sulfonic acid.
| Compound Name | 2-morpholin-4-ylsulfonylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 126656739 |
| Molecular Formula | C7H15NO6S2 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-morpholin-4-ylsulfonylpropane-2-sulfonic acid |
| SMILES | CC(C)(S(=O)(=O)O)S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C7H15NO6S2/c1-7(2,16(11,12)13)15(9,10)8-3-5-14-6-4-8/h3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | QIGUCYMXALEZDJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|