C12H23F2NO6S2 — CID 89233419
4,4-difluoro-3-methyl-5-morpholin-4-ylsulfonylheptane-3-sulfonic acid (PubChem CID 89233419) has the molecular formula C12H23F2NO6S2 and a molecular weight of 379.45 g/mol. Its IUPAC name is 4,4-difluoro-3-methyl-5-morpholin-4-ylsulfonylheptane-3-sulfonic acid.
| Compound Name | 4,4-difluoro-3-methyl-5-morpholin-4-ylsulfonylheptane-3-sulfonic acid |
|---|---|
| PubChem CID | 89233419 |
| Molecular Formula | C12H23F2NO6S2 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4,4-difluoro-3-methyl-5-morpholin-4-ylsulfonylheptane-3-sulfonic acid |
| SMILES | CCC(C(F)(F)C(C)(CC)S(=O)(=O)O)S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H23F2NO6S2/c1-4-10(22(16,17)15-6-8-21-9-7-15)12(13,14)11(3,5-2)23(18,19)20/h10H,4-9H2,1-3H3,(H,18,19,20) |
| InChIKey | LSRHZEFHSPJCIC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|