C15H29F2NO5S2 — CID 89153481
5-(azocan-1-ylsulfonyl)-4,4-difluoro-5-methylheptane-3-sulfonic acid (PubChem CID 89153481) has the molecular formula C15H29F2NO5S2 and a molecular weight of 405.53 g/mol. Its IUPAC name is 5-(azocan-1-ylsulfonyl)-4,4-difluoro-5-methylheptane-3-sulfonic acid.
| Compound Name | 5-(azocan-1-ylsulfonyl)-4,4-difluoro-5-methylheptane-3-sulfonic acid |
|---|---|
| PubChem CID | 89153481 |
| Molecular Formula | C15H29F2NO5S2 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 5-(azocan-1-ylsulfonyl)-4,4-difluoro-5-methylheptane-3-sulfonic acid |
| SMILES | CCC(C(F)(F)C(C)(CC)S(=O)(=O)N1CCCCCCC1)S(=O)(=O)O |
| InChI | InChI=1S/C15H29F2NO5S2/c1-4-13(24(19,20)21)15(16,17)14(3,5-2)25(22,23)18-11-9-7-6-8-10-12-18/h13H,4-12H2,1-3H3,(H,19,20,21) |
| InChIKey | KKEXFWFRKMDJOH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|