C9H19NO5S2 — CID 118052248
3-methyl-3-pyrrolidin-1-ylsulfonylbutane-2-sulfonic acid (PubChem CID 118052248) has the molecular formula C9H19NO5S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-methyl-3-pyrrolidin-1-ylsulfonylbutane-2-sulfonic acid.
| Compound Name | 3-methyl-3-pyrrolidin-1-ylsulfonylbutane-2-sulfonic acid |
|---|---|
| PubChem CID | 118052248 |
| Molecular Formula | C9H19NO5S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-methyl-3-pyrrolidin-1-ylsulfonylbutane-2-sulfonic acid |
| SMILES | CC(C(C)(C)S(=O)(=O)N1CCCC1)S(=O)(=O)O |
| InChI | InChI=1S/C9H19NO5S2/c1-8(16(11,12)13)9(2,3)17(14,15)10-6-4-5-7-10/h8H,4-7H2,1-3H3,(H,11,12,13) |
| InChIKey | YZODUSMXRQBRCW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|