C10H23N3O2S — CID 115310584
N-(1-amino-2,3-dimethylbutan-2-yl)pyrrolidine-1-sulfonamide (PubChem CID 115310584) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 115310584 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)pyrrolidine-1-sulfonamide |
| SMILES | CC(C)C(C)(CN)NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C10H23N3O2S/c1-9(2)10(3,8-11)12-16(14,15)13-6-4-5-7-13/h9,12H,4-8,11H2,1-3H3 |
| InChIKey | DNLNPOXGHNWVLV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |