C9H13Cl3F3NO3S — CID 134101402
1,1,1-trichloro-3,3,3-trifluoro-2-(piperidin-1-ylsulfonylmethyl)propan-2-ol (PubChem CID 134101402) has the molecular formula C9H13Cl3F3NO3S and a molecular weight of 378.63 g/mol. Its IUPAC name is 1,1,1-trichloro-3,3,3-trifluoro-2-(piperidin-1-ylsulfonylmethyl)propan-2-ol.
| Compound Name | 1,1,1-trichloro-3,3,3-trifluoro-2-(piperidin-1-ylsulfonylmethyl)propan-2-ol |
|---|---|
| PubChem CID | 134101402 |
| Molecular Formula | C9H13Cl3F3NO3S |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 1,1,1-trichloro-3,3,3-trifluoro-2-(piperidin-1-ylsulfonylmethyl)propan-2-ol |
| SMILES | O=S(=O)(CC(O)(C(F)(F)F)C(Cl)(Cl)Cl)N1CCCCC1 |
| InChI | InChI=1S/C9H13Cl3F3NO3S/c10-8(11,12)7(17,9(13,14)15)6-20(18,19)16-4-2-1-3-5-16/h17H,1-6H2 |
| InChIKey | BXSKULXWGNITNU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|