C4H3F6O4S- — CID 59445695
3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 59445695) has the molecular formula C4H3F6O4S- and a molecular weight of 261.12 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 59445695 |
| Molecular Formula | C4H3F6O4S- |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H4F6O4S/c5-3(6,7)2(11,4(8,9)10)1-15(12,13)14/h11H,1H2,(H,12,13,14)/p-1 |
| InChIKey | RCLHAAAJYVMDLA-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|