C3HF6O4S- — CID 23533129
1,1,1,3,3,3-hexafluoro-2-hydroxypropane-2-sulfonate (PubChem CID 23533129) has the molecular formula C3HF6O4S- and a molecular weight of 247.09 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-hydroxypropane-2-sulfonate.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-hydroxypropane-2-sulfonate |
|---|---|
| PubChem CID | 23533129 |
| Molecular Formula | C3HF6O4S- |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 246.95 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-hydroxypropane-2-sulfonate |
| SMILES | O=S(=O)([O-])C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3H2F6O4S/c4-2(5,6)1(10,3(7,8)9)14(11,12)13/h10H,(H,11,12,13)/p-1 |
| InChIKey | XGZCFWHFROMKNP-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|