C5H7F4KO3S — CID 145140204
potassium 2,2,4,4-tetrafluoropentane-1-sulfonate (PubChem CID 145140204) has the molecular formula C5H7F4KO3S and a molecular weight of 262.26 g/mol. Its IUPAC name is potassium 2,2,4,4-tetrafluoropentane-1-sulfonate.
| Compound Name | potassium 2,2,4,4-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 145140204 |
| Molecular Formula | C5H7F4KO3S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | potassium 2,2,4,4-tetrafluoropentane-1-sulfonate |
| SMILES | CC(F)(F)CC(F)(F)CS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C5H8F4O3S.K/c1-4(6,7)2-5(8,9)3-13(10,11)12;/h2-3H2,1H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | XQFONXCCIPUUBE-UHFFFAOYSA-M |
| XLogP | -1.78 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|