potassium 2,2,4,4-tetrafluoropentane-1-sulfonate

C5H7F4KO3S — CID 145140204

IUPACpotassium 2,2,4,4-tetrafluoropentane-1-sulfonate
SMILESCC(F)(F)CC(F)(F)CS(=O)(=O)[O-].[K+]
InChIInChI=1S/C5H8F4O3S.K/c1-4(6,7)2-5(8,9)3-13(10,11)12;/h2-3H2,1H3,(H,10,11,12);/q;+1/p-1
InChIKeyXQFONXCCIPUUBE-UHFFFAOYSA-M
MW262.26 g/mol
LogP-1.78
Rot. Bonds4

About potassium 2,2,4,4-tetrafluoropentane-1-sulfonate

potassium 2,2,4,4-tetrafluoropentane-1-sulfonate (PubChem CID 145140204) has the molecular formula C5H7F4KO3S and a molecular weight of 262.26 g/mol. Its IUPAC name is potassium 2,2,4,4-tetrafluoropentane-1-sulfonate.

Molecular Properties

Compound Namepotassium 2,2,4,4-tetrafluoropentane-1-sulfonate
PubChem CID145140204
Molecular FormulaC5H7F4KO3S
Molecular Weight262.26 g/mol
Exact Mass261.97
IUPAC Namepotassium 2,2,4,4-tetrafluoropentane-1-sulfonate
SMILESCC(F)(F)CC(F)(F)CS(=O)(=O)[O-].[K+]
InChIInChI=1S/C5H8F4O3S.K/c1-4(6,7)2-5(8,9)3-13(10,11)12;/h2-3H2,1H3,(H,10,11,12);/q;+1/p-1
InChIKeyXQFONXCCIPUUBE-UHFFFAOYSA-M
XLogP-1.78
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 5-1.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze potassium 2,2,4,4-tetrafluoropentane-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2,2,4,4-tetrafluoropentane-1-sulfonate?
The IUPAC name of potassium 2,2,4,4-tetrafluoropentane-1-sulfonate (CID 145140204) is potassium 2,2,4,4-tetrafluoropentane-1-sulfonate.
What is the SMILES notation for potassium 2,2,4,4-tetrafluoropentane-1-sulfonate?
The canonical SMILES for potassium 2,2,4,4-tetrafluoropentane-1-sulfonate is CC(F)(F)CC(F)(F)CS(=O)(=O)[O-].[K+].
What is the InChIKey of potassium 2,2,4,4-tetrafluoropentane-1-sulfonate?
The InChIKey is XQFONXCCIPUUBE-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8F4O3S.K/c1-4(6,7)2-5(8,9)3-13(10,11)12;/h2-3H2,1H3,(H,10,11,12);/q;+1/p-1.
What are the key properties of potassium 2,2,4,4-tetrafluoropentane-1-sulfonate?
potassium 2,2,4,4-tetrafluoropentane-1-sulfonate has a molecular weight of 262.26 g/mol, XLogP of -1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,2,4,4-tetrafluoropentane-1-sulfonate is sourced from PubChem (CID 145140204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).