C16H28MgN2O8S2 — CID 122612533
magnesium bis(2-methyl-2-(2-methylprop-2-enoylamino)propane-1-sulfonate) (PubChem CID 122612533) has the molecular formula C16H28MgN2O8S2 and a molecular weight of 464.85 g/mol. Its IUPAC name is magnesium bis(2-methyl-2-(2-methylprop-2-enoylamino)propane-1-sulfonate).
| Compound Name | magnesium bis(2-methyl-2-(2-methylprop-2-enoylamino)propane-1-sulfonate) |
|---|---|
| PubChem CID | 122612533 |
| Molecular Formula | C16H28MgN2O8S2 |
| Molecular Weight | 464.85 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | magnesium bis(2-methyl-2-(2-methylprop-2-enoylamino)propane-1-sulfonate) |
| SMILES | C=C(C)C(=O)NC(C)(C)CS(=O)(=O)[O-].C=C(C)C(=O)NC(C)(C)CS(=O)(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C8H15NO4S.Mg/c2*1-6(2)7(10)9-8(3,4)5-14(11,12)13;/h2*1,5H2,2-4H3,(H,9,10)(H,11,12,13);/q;;+2/p-2 |
| InChIKey | FCTSUPSCOYDYSS-UHFFFAOYSA-L |
| XLogP | -0.38 |
| TPSA | 172.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.85 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|