C9H18NO4P — CID 87771282
[3-methyl-3-(2-methylprop-2-enoylamino)butyl]phosphonic acid (PubChem CID 87771282) has the molecular formula C9H18NO4P and a molecular weight of 235.22 g/mol. Its IUPAC name is [3-methyl-3-(2-methylprop-2-enoylamino)butyl]phosphonic acid.
| Compound Name | [3-methyl-3-(2-methylprop-2-enoylamino)butyl]phosphonic acid |
|---|---|
| PubChem CID | 87771282 |
| Molecular Formula | C9H18NO4P |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | [3-methyl-3-(2-methylprop-2-enoylamino)butyl]phosphonic acid |
| SMILES | C=C(C)C(=O)NC(C)(C)CCP(=O)(O)O |
| InChI | InChI=1S/C9H18NO4P/c1-7(2)8(11)10-9(3,4)5-6-15(12,13)14/h1,5-6H2,2-4H3,(H,10,11)(H2,12,13,14) |
| InChIKey | FDSICZMOKMVNIA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|