C17H34ClN3O2 — CID 134927050
dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-[3-oxo-3-(propan-2-ylamino)propyl]azanium chloride (PubChem CID 134927050) has the molecular formula C17H34ClN3O2 and a molecular weight of 347.93 g/mol. Its IUPAC name is dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-[3-oxo-3-(propan-2-ylamino)propyl]azanium chloride.
| Compound Name | dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-[3-oxo-3-(propan-2-ylamino)propyl]azanium chloride |
|---|---|
| PubChem CID | 134927050 |
| Molecular Formula | C17H34ClN3O2 |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-[3-oxo-3-(propan-2-ylamino)propyl]azanium chloride |
| SMILES | C=C(C)C(=O)NC(C)(C)CC[N+](C)(C)CCC(=O)NC(C)C.[Cl-] |
| InChI | InChI=1S/C17H33N3O2.ClH/c1-13(2)16(22)19-17(5,6)10-12-20(7,8)11-9-15(21)18-14(3)4;/h14H,1,9-12H2,2-8H3,(H-,18,19,21,22);1H |
| InChIKey | NLJUCEUNXJLXJV-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|