C18H34ClN3O3 — CID 134927069
dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-(3-morpholin-4-yl-3-oxopropyl)azanium chloride (PubChem CID 134927069) has the molecular formula C18H34ClN3O3 and a molecular weight of 375.94 g/mol. Its IUPAC name is dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-(3-morpholin-4-yl-3-oxopropyl)azanium chloride.
| Compound Name | dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-(3-morpholin-4-yl-3-oxopropyl)azanium chloride |
|---|---|
| PubChem CID | 134927069 |
| Molecular Formula | C18H34ClN3O3 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]-(3-morpholin-4-yl-3-oxopropyl)azanium chloride |
| SMILES | C=C(C)C(=O)NC(C)(C)CC[N+](C)(C)CCC(=O)N1CCOCC1.[Cl-] |
| InChI | InChI=1S/C18H33N3O3.ClH/c1-15(2)17(23)19-18(3,4)8-12-21(5,6)11-7-16(22)20-9-13-24-14-10-20;/h1,7-14H2,2-6H3;1H |
| InChIKey | DIKUKUCKPITLCJ-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|