About (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide
(2-morpholin-4-yl-2-oxoethyl) acetate;propanamide (PubChem CID 174960121) has the molecular formula C11H20N2O5
and a molecular weight of 260.29 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide.
Molecular Properties
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide |
| PubChem CID | 174960121 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide |
| SMILES | CC(=O)OCC(=O)N1CCOCC1.CCC(N)=O |
| InChI | InChI=1S/C8H13NO4.C3H7NO/c1-7(10)13-6-8(11)9-2-4-12-5-3-9;1-2-3(4)5/h2-6H2,1H3;2H2,1H3,(H2,4,5) |
| InChIKey | IQWUJRGPWCFZRX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide?
The IUPAC name of (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide (CID 174960121) is (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide.
What is the SMILES notation for (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide?
The canonical SMILES for (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide is CC(=O)OCC(=O)N1CCOCC1.CCC(N)=O.
What is the InChIKey of (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide?
The InChIKey is IQWUJRGPWCFZRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4.C3H7NO/c1-7(10)13-6-8(11)9-2-4-12-5-3-9;1-2-3(4)5/h2-6H2,1H3;2H2,1H3,(H2,4,5).
What are the key properties of (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide?
(2-morpholin-4-yl-2-oxoethyl) acetate;propanamide has a molecular weight of 260.29 g/mol, XLogP of -0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-morpholin-4-yl-2-oxoethyl) acetate;propanamide is sourced from PubChem (CID 174960121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).